C43H43O5P — CID 11365883
(3aR,8aR)-2,2-dimethyl-4,4,8,8-tetraphenyl-6-[(1R,2S)-2-phenylcyclohexyl]oxy-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine (PubChem CID 11365883) has the molecular formula C43H43O5P and a molecular weight of 670.79 g/mol. Its IUPAC name is (3aR,8aR)-2,2-dimethyl-4,4,8,8-tetraphenyl-6-[(1R,2S)-2-phenylcyclohexyl]oxy-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine.
| Compound Name | (3aR,8aR)-2,2-dimethyl-4,4,8,8-tetraphenyl-6-[(1R,2S)-2-phenylcyclohexyl]oxy-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine |
|---|---|
| PubChem CID | 11365883 |
| Molecular Formula | C43H43O5P |
| Molecular Weight | 670.79 g/mol |
| Exact Mass | 670.28 |
| IUPAC Name | (3aR,8aR)-2,2-dimethyl-4,4,8,8-tetraphenyl-6-[(1R,2S)-2-phenylcyclohexyl]oxy-3a,8a-dihydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepine |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)C(c1ccccc1)(c1ccccc1)OP(O[C@@H]1CCCC[C@H]1c1ccccc1)OC2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H43O5P/c1-41(2)44-39-40(45-41)43(35-26-14-6-15-27-35,36-28-16-7-17-29-36)48-49(46-38-31-19-18-30-37(38)32-20-8-3-9-21-32)47-42(39,33-22-10-4-11-23-33)34-24-12-5-13-25-34/h3-17,20-29,37-40H,18-19,30-31H2,1-2H3/t37-,38+,39+,40+/m0/s1 |
| InChIKey | SHDJOCUQGFESBQ-BGFKDDMLSA-N |
| XLogP | 10.41 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.79 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|