C32H48N2O8SSi2 — CID 11365925
[(3R,4R,5S,11S)-3-(2,4-dioxopyrimidin-1-yl)-7,7,9,9-tetra(propan-2-yl)-6,8,10-trioxa-2-thia-7,9-disilatricyclo[9.3.0.01,5]tetradecan-4-yl] 4-methoxybenzoate (PubChem CID 11365925) has the molecular formula C32H48N2O8SSi2 and a molecular weight of 676.98 g/mol. Its IUPAC name is [(3R,4R,5S,11S)-3-(2,4-dioxopyrimidin-1-yl)-7,7,9,9-tetra(propan-2-yl)-6,8,10-trioxa-2-thia-7,9-disilatricyclo[9.3.0.01,5]tetradecan-4-yl] 4-methoxybenzoate.
| Compound Name | [(3R,4R,5S,11S)-3-(2,4-dioxopyrimidin-1-yl)-7,7,9,9-tetra(propan-2-yl)-6,8,10-trioxa-2-thia-7,9-disilatricyclo[9.3.0.01,5]tetradecan-4-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 11365925 |
| Molecular Formula | C32H48N2O8SSi2 |
| Molecular Weight | 676.98 g/mol |
| Exact Mass | 676.27 |
| IUPAC Name | [(3R,4R,5S,11S)-3-(2,4-dioxopyrimidin-1-yl)-7,7,9,9-tetra(propan-2-yl)-6,8,10-trioxa-2-thia-7,9-disilatricyclo[9.3.0.01,5]tetradecan-4-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@H]2[C@H](n3ccc(=O)[nH]c3=O)SC34CCC[C@@H]3O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@@H]24)cc1 |
| InChI | InChI=1S/C32H48N2O8SSi2/c1-19(2)44(20(3)4)40-25-11-10-17-32(25)28(41-45(42-44,21(5)6)22(7)8)27(29(43-32)34-18-16-26(35)33-31(34)37)39-30(36)23-12-14-24(38-9)15-13-23/h12-16,18-22,25,27-29H,10-11,17H2,1-9H3,(H,33,35,37)/t25-,27+,28-,29+,32?/m0/s1 |
| InChIKey | QDQCTSCRZFJZIK-SRXJMCHPSA-N |
| XLogP | 6.26 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.98 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|