C45H62GeO4Sn — CID 11366443
trans-diethyl (3S,4S)-3-(1-tributylstannylethenyl)-4-(1-triphenylgermylethenyl)cyclopentane-1,1-dicarboxylate (PubChem CID 11366443) has the molecular formula C45H62GeO4Sn and a molecular weight of 858.31 g/mol. Its IUPAC name is trans-diethyl (3S,4S)-3-(1-tributylstannylethenyl)-4-(1-triphenylgermylethenyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (3S,4S)-3-(1-tributylstannylethenyl)-4-(1-triphenylgermylethenyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11366443 |
| Molecular Formula | C45H62GeO4Sn |
| Molecular Weight | 858.31 g/mol |
| Exact Mass | 860.29 |
| IUPAC Name | trans-diethyl (3S,4S)-3-(1-tributylstannylethenyl)-4-(1-triphenylgermylethenyl)cyclopentane-1,1-dicarboxylate |
| SMILES | C=C([C@H]1CC(C(=O)OCC)(C(=O)OCC)C[C@@H]1C(=C)[Sn](CCCC)(CCCC)CCCC)[Ge](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H35GeO4.3C4H9.Sn/c1-5-26-23-33(31(35)37-6-2,32(36)38-7-3)24-30(26)25(4)34(27-17-11-8-12-18-27,28-19-13-9-14-20-28)29-21-15-10-16-22-29;3*1-3-4-2;/h8-22,26,30H,1,4,6-7,23-24H2,2-3H3;3*1,3-4H2,2H3;/t26-,30+;;;;/m0..../s1 |
| InChIKey | ZGGIJFWHCOJEFT-FNUXNBGMSA-N |
| XLogP | 9.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.31 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|