C54H116O8Si4 — CID 11366656
[(3R,7R,11S,15S,18R)-18,19-dihydroxy-3,7,11,15,19-pentamethyl-3,7,11,15-tetrakis(triethylsilyloxy)icosyl] 2,2-dimethylpropanoate (PubChem CID 11366656) has the molecular formula C54H116O8Si4 and a molecular weight of 1005.86 g/mol. Its IUPAC name is [(3R,7R,11S,15S,18R)-18,19-dihydroxy-3,7,11,15,19-pentamethyl-3,7,11,15-tetrakis(triethylsilyloxy)icosyl] 2,2-dimethylpropanoate.
| Compound Name | [(3R,7R,11S,15S,18R)-18,19-dihydroxy-3,7,11,15,19-pentamethyl-3,7,11,15-tetrakis(triethylsilyloxy)icosyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11366656 |
| Molecular Formula | C54H116O8Si4 |
| Molecular Weight | 1005.86 g/mol |
| Exact Mass | 1004.77 |
| IUPAC Name | [(3R,7R,11S,15S,18R)-18,19-dihydroxy-3,7,11,15,19-pentamethyl-3,7,11,15-tetrakis(triethylsilyloxy)icosyl] 2,2-dimethylpropanoate |
| SMILES | CC[Si](CC)(CC)O[C@@](C)(CCC[C@](C)(CCC[C@](C)(CCOC(=O)C(C)(C)C)O[Si](CC)(CC)CC)O[Si](CC)(CC)CC)CCC[C@@](C)(CC[C@@H](O)C(C)(C)O)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C54H116O8Si4/c1-22-63(23-2,24-3)59-51(18,40-35-42-53(20,44-37-47(55)50(16,17)57)61-65(28-7,29-8)30-9)38-34-39-52(19,60-64(25-4,26-5)27-6)41-36-43-54(21,62-66(31-10,32-11)33-12)45-46-58-48(56)49(13,14)15/h47,55,57H,22-46H2,1-21H3/t47-,51+,52-,53+,54-/m1/s1 |
| InChIKey | FQLHIJPRSFGEBP-XNSZXULDSA-N |
| XLogP | 16.51 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.86 |
| LogP ≤ 5 | 16.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|