3-oxocyclopentene-1-carboxylic acid

C6H6O3 — CID 11366989

IUPAC3-oxocyclopentene-1-carboxylic acid
SMILESO=C1C=C(C(=O)O)CC1
InChIInChI=1S/C6H6O3/c7-5-2-1-4(3-5)6(8)9/h3H,1-2H2,(H,8,9)
InChIKeyOVRALHWIAFCVSV-UHFFFAOYSA-N
MW126.11 g/mol
LogP0.36
Rot. Bonds1

About 3-oxocyclopentene-1-carboxylic acid

3-oxocyclopentene-1-carboxylic acid (PubChem CID 11366989) has the molecular formula C6H6O3 and a molecular weight of 126.11 g/mol. Its IUPAC name is 3-oxocyclopentene-1-carboxylic acid.

Molecular Properties

Compound Name3-oxocyclopentene-1-carboxylic acid
PubChem CID11366989
Molecular FormulaC6H6O3
Molecular Weight126.11 g/mol
Exact Mass126.03
IUPAC Name3-oxocyclopentene-1-carboxylic acid
SMILESO=C1C=C(C(=O)O)CC1
InChIInChI=1S/C6H6O3/c7-5-2-1-4(3-5)6(8)9/h3H,1-2H2,(H,8,9)
InChIKeyOVRALHWIAFCVSV-UHFFFAOYSA-N
XLogP0.36
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500126.11
LogP ≤ 50.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-oxocyclopentene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-oxocyclopentene-1-carboxylic acid?
The IUPAC name of 3-oxocyclopentene-1-carboxylic acid (CID 11366989) is 3-oxocyclopentene-1-carboxylic acid.
What is the SMILES notation for 3-oxocyclopentene-1-carboxylic acid?
The canonical SMILES for 3-oxocyclopentene-1-carboxylic acid is O=C1C=C(C(=O)O)CC1.
What is the InChIKey of 3-oxocyclopentene-1-carboxylic acid?
The InChIKey is OVRALHWIAFCVSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3/c7-5-2-1-4(3-5)6(8)9/h3H,1-2H2,(H,8,9).
What are the key properties of 3-oxocyclopentene-1-carboxylic acid?
3-oxocyclopentene-1-carboxylic acid has a molecular weight of 126.11 g/mol, XLogP of 0.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxocyclopentene-1-carboxylic acid is sourced from PubChem (CID 11366989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).