About 1-hydroxypurine
1-hydroxypurine (PubChem CID 11367017) has the molecular formula C5H4N4O
and a molecular weight of 136.11 g/mol. Its IUPAC name is 1-hydroxypurine.
Molecular Properties
| Compound Name | 1-hydroxypurine |
| PubChem CID | 11367017 |
| Molecular Formula | C5H4N4O |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 1-hydroxypurine |
| SMILES | On1cnc2ncnc-2c1 |
| InChI | InChI=1S/C5H4N4O/c10-9-1-4-5(8-3-9)7-2-6-4/h1-3,10H |
| InChIKey | TUUQUSLFBYMDFB-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxypurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypurine?
The IUPAC name of 1-hydroxypurine (CID 11367017) is 1-hydroxypurine.
What is the SMILES notation for 1-hydroxypurine?
The canonical SMILES for 1-hydroxypurine is On1cnc2ncnc-2c1.
What is the InChIKey of 1-hydroxypurine?
The InChIKey is TUUQUSLFBYMDFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4O/c10-9-1-4-5(8-3-9)7-2-6-4/h1-3,10H.
What are the key properties of 1-hydroxypurine?
1-hydroxypurine has a molecular weight of 136.11 g/mol, XLogP of 0.02, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypurine is sourced from PubChem (CID 11367017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).