About prop-2-enyl (3S)-3-hydroxybutanoate
prop-2-enyl (3S)-3-hydroxybutanoate (PubChem CID 11367058) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is prop-2-enyl (3S)-3-hydroxybutanoate.
Molecular Properties
| Compound Name | prop-2-enyl (3S)-3-hydroxybutanoate |
| PubChem CID | 11367058 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | prop-2-enyl (3S)-3-hydroxybutanoate |
| SMILES | C=CCOC(=O)C[C@H](C)O |
| InChI | InChI=1S/C7H12O3/c1-3-4-10-7(9)5-6(2)8/h3,6,8H,1,4-5H2,2H3/t6-/m0/s1 |
| InChIKey | FOCSDZKINLISTL-LURJTMIESA-N |
| XLogP | 0.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl (3S)-3-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl (3S)-3-hydroxybutanoate?
The IUPAC name of prop-2-enyl (3S)-3-hydroxybutanoate (CID 11367058) is prop-2-enyl (3S)-3-hydroxybutanoate.
What is the SMILES notation for prop-2-enyl (3S)-3-hydroxybutanoate?
The canonical SMILES for prop-2-enyl (3S)-3-hydroxybutanoate is C=CCOC(=O)C[C@H](C)O.
What is the InChIKey of prop-2-enyl (3S)-3-hydroxybutanoate?
The InChIKey is FOCSDZKINLISTL-LURJTMIESA-N. The full InChI is InChI=1S/C7H12O3/c1-3-4-10-7(9)5-6(2)8/h3,6,8H,1,4-5H2,2H3/t6-/m0/s1.
What are the key properties of prop-2-enyl (3S)-3-hydroxybutanoate?
prop-2-enyl (3S)-3-hydroxybutanoate has a molecular weight of 144.17 g/mol, XLogP of 0.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl (3S)-3-hydroxybutanoate is sourced from PubChem (CID 11367058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).