About 2,2-dimethyl-(514C)1,3-dioxane-4,6-dione
2,2-dimethyl-(514C)1,3-dioxane-4,6-dione (PubChem CID 11367066) has the molecular formula C6H8O4
and a molecular weight of 146.12 g/mol. Its IUPAC name is 2,2-dimethyl-(514C)1,3-dioxane-4,6-dione.
Molecular Properties
| Compound Name | 2,2-dimethyl-(514C)1,3-dioxane-4,6-dione |
| PubChem CID | 11367066 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 146.12 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 2,2-dimethyl-(514C)1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)[14CH2]C(=O)O1 |
| InChI | InChI=1S/C6H8O4/c1-6(2)9-4(7)3-5(8)10-6/h3H2,1-2H3/i3+2 |
| InChIKey | GXHFUVWIGNLZSC-YZRHJBSPSA-N |
| XLogP | 0.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.12 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-(514C)1,3-dioxane-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-(514C)1,3-dioxane-4,6-dione?
The IUPAC name of 2,2-dimethyl-(514C)1,3-dioxane-4,6-dione (CID 11367066) is 2,2-dimethyl-(514C)1,3-dioxane-4,6-dione.
What is the SMILES notation for 2,2-dimethyl-(514C)1,3-dioxane-4,6-dione?
The canonical SMILES for 2,2-dimethyl-(514C)1,3-dioxane-4,6-dione is CC1(C)OC(=O)[14CH2]C(=O)O1.
What is the InChIKey of 2,2-dimethyl-(514C)1,3-dioxane-4,6-dione?
The InChIKey is GXHFUVWIGNLZSC-YZRHJBSPSA-N. The full InChI is InChI=1S/C6H8O4/c1-6(2)9-4(7)3-5(8)10-6/h3H2,1-2H3/i3+2.
What are the key properties of 2,2-dimethyl-(514C)1,3-dioxane-4,6-dione?
2,2-dimethyl-(514C)1,3-dioxane-4,6-dione has a molecular weight of 146.12 g/mol, XLogP of 0.21, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-(514C)1,3-dioxane-4,6-dione is sourced from PubChem (CID 11367066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).