About ethyl 2-chlorobut-3-enoate
ethyl 2-chlorobut-3-enoate (PubChem CID 11367084) has the molecular formula C6H9ClO2
and a molecular weight of 148.59 g/mol. Its IUPAC name is ethyl 2-chlorobut-3-enoate.
Molecular Properties
| Compound Name | ethyl 2-chlorobut-3-enoate |
| PubChem CID | 11367084 |
| Molecular Formula | C6H9ClO2 |
| Molecular Weight | 148.59 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | ethyl 2-chlorobut-3-enoate |
| SMILES | C=CC(Cl)C(=O)OCC |
| InChI | InChI=1S/C6H9ClO2/c1-3-5(7)6(8)9-4-2/h3,5H,1,4H2,2H3 |
| InChIKey | ZPSUEZJWHBACKQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.59 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-chlorobut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-chlorobut-3-enoate?
The IUPAC name of ethyl 2-chlorobut-3-enoate (CID 11367084) is ethyl 2-chlorobut-3-enoate.
What is the SMILES notation for ethyl 2-chlorobut-3-enoate?
The canonical SMILES for ethyl 2-chlorobut-3-enoate is C=CC(Cl)C(=O)OCC.
What is the InChIKey of ethyl 2-chlorobut-3-enoate?
The InChIKey is ZPSUEZJWHBACKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClO2/c1-3-5(7)6(8)9-4-2/h3,5H,1,4H2,2H3.
What are the key properties of ethyl 2-chlorobut-3-enoate?
ethyl 2-chlorobut-3-enoate has a molecular weight of 148.59 g/mol, XLogP of 1.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-chlorobut-3-enoate is sourced from PubChem (CID 11367084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).