About 6-methoxy-2,4-dimethylpyridin-3-ol
6-methoxy-2,4-dimethylpyridin-3-ol (PubChem CID 11367108) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 6-methoxy-2,4-dimethylpyridin-3-ol.
Molecular Properties
| Compound Name | 6-methoxy-2,4-dimethylpyridin-3-ol |
| PubChem CID | 11367108 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 6-methoxy-2,4-dimethylpyridin-3-ol |
| SMILES | COc1cc(C)c(O)c(C)n1 |
| InChI | InChI=1S/C8H11NO2/c1-5-4-7(11-3)9-6(2)8(5)10/h4,10H,1-3H3 |
| InChIKey | UKTMWJCDPSKCPD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methoxy-2,4-dimethylpyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2,4-dimethylpyridin-3-ol?
The IUPAC name of 6-methoxy-2,4-dimethylpyridin-3-ol (CID 11367108) is 6-methoxy-2,4-dimethylpyridin-3-ol.
What is the SMILES notation for 6-methoxy-2,4-dimethylpyridin-3-ol?
The canonical SMILES for 6-methoxy-2,4-dimethylpyridin-3-ol is COc1cc(C)c(O)c(C)n1.
What is the InChIKey of 6-methoxy-2,4-dimethylpyridin-3-ol?
The InChIKey is UKTMWJCDPSKCPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-5-4-7(11-3)9-6(2)8(5)10/h4,10H,1-3H3.
What are the key properties of 6-methoxy-2,4-dimethylpyridin-3-ol?
6-methoxy-2,4-dimethylpyridin-3-ol has a molecular weight of 153.18 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2,4-dimethylpyridin-3-ol is sourced from PubChem (CID 11367108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).