C10H14N2O — CID 11367331
2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethanol (PubChem CID 11367331) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethanol.
| Compound Name | 2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethanol |
|---|---|
| PubChem CID | 11367331 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethanol |
| SMILES | OCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C10H14N2O/c13-7-5-9-4-3-8-2-1-6-11-10(8)12-9/h3-4,13H,1-2,5-7H2,(H,11,12) |
| InChIKey | WEMUNMQFXOILNO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |