About 4-(3-methyl-1,3-oxazolidin-2-yl)phenol
4-(3-methyl-1,3-oxazolidin-2-yl)phenol (PubChem CID 11367345) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 4-(3-methyl-1,3-oxazolidin-2-yl)phenol.
Molecular Properties
| Compound Name | 4-(3-methyl-1,3-oxazolidin-2-yl)phenol |
| PubChem CID | 11367345 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 4-(3-methyl-1,3-oxazolidin-2-yl)phenol |
| SMILES | CN1CCOC1c1ccc(O)cc1 |
| InChI | InChI=1S/C10H13NO2/c1-11-6-7-13-10(11)8-2-4-9(12)5-3-8/h2-5,10,12H,6-7H2,1H3 |
| InChIKey | TYVBDKQUZNZDDW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-methyl-1,3-oxazolidin-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methyl-1,3-oxazolidin-2-yl)phenol?
The IUPAC name of 4-(3-methyl-1,3-oxazolidin-2-yl)phenol (CID 11367345) is 4-(3-methyl-1,3-oxazolidin-2-yl)phenol.
What is the SMILES notation for 4-(3-methyl-1,3-oxazolidin-2-yl)phenol?
The canonical SMILES for 4-(3-methyl-1,3-oxazolidin-2-yl)phenol is CN1CCOC1c1ccc(O)cc1.
What is the InChIKey of 4-(3-methyl-1,3-oxazolidin-2-yl)phenol?
The InChIKey is TYVBDKQUZNZDDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-11-6-7-13-10(11)8-2-4-9(12)5-3-8/h2-5,10,12H,6-7H2,1H3.
What are the key properties of 4-(3-methyl-1,3-oxazolidin-2-yl)phenol?
4-(3-methyl-1,3-oxazolidin-2-yl)phenol has a molecular weight of 179.22 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methyl-1,3-oxazolidin-2-yl)phenol is sourced from PubChem (CID 11367345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).