About 2-bromo-N,N-dimethylpropanamide
2-bromo-N,N-dimethylpropanamide (PubChem CID 11367348) has the molecular formula C5H10BrNO
and a molecular weight of 180.04 g/mol. Its IUPAC name is 2-bromo-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 2-bromo-N,N-dimethylpropanamide |
| PubChem CID | 11367348 |
| Molecular Formula | C5H10BrNO |
| Molecular Weight | 180.04 g/mol |
| Exact Mass | 178.99 |
| IUPAC Name | 2-bromo-N,N-dimethylpropanamide |
| SMILES | CC(Br)C(=O)N(C)C |
| InChI | InChI=1S/C5H10BrNO/c1-4(6)5(8)7(2)3/h4H,1-3H3 |
| InChIKey | ZEDHSSVDQTYBRV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.04 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N,N-dimethylpropanamide?
The IUPAC name of 2-bromo-N,N-dimethylpropanamide (CID 11367348) is 2-bromo-N,N-dimethylpropanamide.
What is the SMILES notation for 2-bromo-N,N-dimethylpropanamide?
The canonical SMILES for 2-bromo-N,N-dimethylpropanamide is CC(Br)C(=O)N(C)C.
What is the InChIKey of 2-bromo-N,N-dimethylpropanamide?
The InChIKey is ZEDHSSVDQTYBRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10BrNO/c1-4(6)5(8)7(2)3/h4H,1-3H3.
What are the key properties of 2-bromo-N,N-dimethylpropanamide?
2-bromo-N,N-dimethylpropanamide has a molecular weight of 180.04 g/mol, XLogP of 0.86, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N,N-dimethylpropanamide is sourced from PubChem (CID 11367348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).