C11H18O2 — CID 11367391
(1R,3aR,8R,8aR)-8-hydroxy-1-methyl-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-4-one (PubChem CID 11367391) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (1R,3aR,8R,8aR)-8-hydroxy-1-methyl-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-4-one.
| Compound Name | (1R,3aR,8R,8aR)-8-hydroxy-1-methyl-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-4-one |
|---|---|
| PubChem CID | 11367391 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (1R,3aR,8R,8aR)-8-hydroxy-1-methyl-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-4-one |
| SMILES | C[C@@H]1CC[C@H]2C(=O)CCC[C@@H](O)[C@H]12 |
| InChI | InChI=1S/C11H18O2/c1-7-5-6-8-9(12)3-2-4-10(13)11(7)8/h7-8,10-11,13H,2-6H2,1H3/t7-,8+,10-,11-/m1/s1 |
| InChIKey | DPNXGUFOBXNIDH-JZSSXWJLSA-N |
| XLogP | 1.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |