About 4-ethoxypteridin-2-amine
4-ethoxypteridin-2-amine (PubChem CID 11367513) has the molecular formula C8H9N5O
and a molecular weight of 191.19 g/mol. Its IUPAC name is 4-ethoxypteridin-2-amine.
Molecular Properties
| Compound Name | 4-ethoxypteridin-2-amine |
| PubChem CID | 11367513 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 4-ethoxypteridin-2-amine |
| SMILES | CCOc1nc(N)nc2nccnc12 |
| InChI | InChI=1S/C8H9N5O/c1-2-14-7-5-6(11-4-3-10-5)12-8(9)13-7/h3-4H,2H2,1H3,(H2,9,11,12,13) |
| InChIKey | VAJUOMDDHCPZHT-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 86.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-ethoxypteridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxypteridin-2-amine?
The IUPAC name of 4-ethoxypteridin-2-amine (CID 11367513) is 4-ethoxypteridin-2-amine.
What is the SMILES notation for 4-ethoxypteridin-2-amine?
The canonical SMILES for 4-ethoxypteridin-2-amine is CCOc1nc(N)nc2nccnc12.
What is the InChIKey of 4-ethoxypteridin-2-amine?
The InChIKey is VAJUOMDDHCPZHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5O/c1-2-14-7-5-6(11-4-3-10-5)12-8(9)13-7/h3-4H,2H2,1H3,(H2,9,11,12,13).
What are the key properties of 4-ethoxypteridin-2-amine?
4-ethoxypteridin-2-amine has a molecular weight of 191.19 g/mol, XLogP of 0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxypteridin-2-amine is sourced from PubChem (CID 11367513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).