About propan-2-yl 2-phenoxyacetate
propan-2-yl 2-phenoxyacetate (PubChem CID 11367560) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is propan-2-yl 2-phenoxyacetate.
Molecular Properties
| Compound Name | propan-2-yl 2-phenoxyacetate |
| PubChem CID | 11367560 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | propan-2-yl 2-phenoxyacetate |
| SMILES | CC(C)OC(=O)COc1ccccc1 |
| InChI | InChI=1S/C11H14O3/c1-9(2)14-11(12)8-13-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | ZUGZAGVRSXHCOA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl 2-phenoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-phenoxyacetate?
The IUPAC name of propan-2-yl 2-phenoxyacetate (CID 11367560) is propan-2-yl 2-phenoxyacetate.
What is the SMILES notation for propan-2-yl 2-phenoxyacetate?
The canonical SMILES for propan-2-yl 2-phenoxyacetate is CC(C)OC(=O)COc1ccccc1.
What is the InChIKey of propan-2-yl 2-phenoxyacetate?
The InChIKey is ZUGZAGVRSXHCOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-9(2)14-11(12)8-13-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3.
What are the key properties of propan-2-yl 2-phenoxyacetate?
propan-2-yl 2-phenoxyacetate has a molecular weight of 194.23 g/mol, XLogP of 2.02, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-phenoxyacetate is sourced from PubChem (CID 11367560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).