About (8S,8aR)-3-chloro-8-methyl-8,8a-dihydro-1H-azulen-2-one
(8S,8aR)-3-chloro-8-methyl-8,8a-dihydro-1H-azulen-2-one (PubChem CID 11367570) has the molecular formula C11H11ClO
and a molecular weight of 194.66 g/mol. Its IUPAC name is (8S,8aR)-3-chloro-8-methyl-8,8a-dihydro-1H-azulen-2-one.
Molecular Properties
| Compound Name | (8S,8aR)-3-chloro-8-methyl-8,8a-dihydro-1H-azulen-2-one |
| PubChem CID | 11367570 |
| Molecular Formula | C11H11ClO |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | (8S,8aR)-3-chloro-8-methyl-8,8a-dihydro-1H-azulen-2-one |
| SMILES | C[C@H]1C=CC=CC2=C(Cl)C(=O)C[C@@H]21 |
| InChI | InChI=1S/C11H11ClO/c1-7-4-2-3-5-8-9(7)6-10(13)11(8)12/h2-5,7,9H,6H2,1H3/t7-,9+/m0/s1 |
| InChIKey | SUHJHUKRMQVKER-IONNQARKSA-N |
| XLogP | 2.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze (8S,8aR)-3-chloro-8-methyl-8,8a-dihydro-1H-azulen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8S,8aR)-3-chloro-8-methyl-8,8a-dihydro-1H-azulen-2-one?
The IUPAC name of (8S,8aR)-3-chloro-8-methyl-8,8a-dihydro-1H-azulen-2-one (CID 11367570) is (8S,8aR)-3-chloro-8-methyl-8,8a-dihydro-1H-azulen-2-one.
What is the SMILES notation for (8S,8aR)-3-chloro-8-methyl-8,8a-dihydro-1H-azulen-2-one?
The canonical SMILES for (8S,8aR)-3-chloro-8-methyl-8,8a-dihydro-1H-azulen-2-one is C[C@H]1C=CC=CC2=C(Cl)C(=O)C[C@@H]21.
What is the InChIKey of (8S,8aR)-3-chloro-8-methyl-8,8a-dihydro-1H-azulen-2-one?
The InChIKey is SUHJHUKRMQVKER-IONNQARKSA-N. The full InChI is InChI=1S/C11H11ClO/c1-7-4-2-3-5-8-9(7)6-10(13)11(8)12/h2-5,7,9H,6H2,1H3/t7-,9+/m0/s1.
What are the key properties of (8S,8aR)-3-chloro-8-methyl-8,8a-dihydro-1H-azulen-2-one?
(8S,8aR)-3-chloro-8-methyl-8,8a-dihydro-1H-azulen-2-one has a molecular weight of 194.66 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (8S,8aR)-3-chloro-8-methyl-8,8a-dihydro-1H-azulen-2-one is sourced from PubChem (CID 11367570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).