About 1-(2,2,2-trifluoroethyl)imidazole-4,5-dicarbonitrile
1-(2,2,2-trifluoroethyl)imidazole-4,5-dicarbonitrile (PubChem CID 11367647) has the molecular formula C7H3F3N4
and a molecular weight of 200.12 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)imidazole-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 1-(2,2,2-trifluoroethyl)imidazole-4,5-dicarbonitrile |
| PubChem CID | 11367647 |
| Molecular Formula | C7H3F3N4 |
| Molecular Weight | 200.12 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1ncn(CC(F)(F)F)c1C#N |
| InChI | InChI=1S/C7H3F3N4/c8-7(9,10)3-14-4-13-5(1-11)6(14)2-12/h4H,3H2 |
| InChIKey | AFRUEMMDVIXOGW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.12 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,2,2-trifluoroethyl)imidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2,2-trifluoroethyl)imidazole-4,5-dicarbonitrile?
The IUPAC name of 1-(2,2,2-trifluoroethyl)imidazole-4,5-dicarbonitrile (CID 11367647) is 1-(2,2,2-trifluoroethyl)imidazole-4,5-dicarbonitrile.
What is the SMILES notation for 1-(2,2,2-trifluoroethyl)imidazole-4,5-dicarbonitrile?
The canonical SMILES for 1-(2,2,2-trifluoroethyl)imidazole-4,5-dicarbonitrile is N#Cc1ncn(CC(F)(F)F)c1C#N.
What is the InChIKey of 1-(2,2,2-trifluoroethyl)imidazole-4,5-dicarbonitrile?
The InChIKey is AFRUEMMDVIXOGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3F3N4/c8-7(9,10)3-14-4-13-5(1-11)6(14)2-12/h4H,3H2.
What are the key properties of 1-(2,2,2-trifluoroethyl)imidazole-4,5-dicarbonitrile?
1-(2,2,2-trifluoroethyl)imidazole-4,5-dicarbonitrile has a molecular weight of 200.12 g/mol, XLogP of 1.19, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2,2-trifluoroethyl)imidazole-4,5-dicarbonitrile is sourced from PubChem (CID 11367647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).