C12H15N3 — CID 11367665
N,N-dimethyl-1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4,8(12),10-tetraen-7-amine (PubChem CID 11367665) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is N,N-dimethyl-1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4,8(12),10-tetraen-7-amine.
| Compound Name | N,N-dimethyl-1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4,8(12),10-tetraen-7-amine |
|---|---|
| PubChem CID | 11367665 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | N,N-dimethyl-1,2-diazatricyclo[6.3.1.04,12]dodeca-2,4,8(12),10-tetraen-7-amine |
| SMILES | CN(C)C1CC=c2cnn3c2=C1CC=C3 |
| InChI | InChI=1S/C12H15N3/c1-14(2)11-6-5-9-8-13-15-7-3-4-10(11)12(9)15/h3,5,7-8,11H,4,6H2,1-2H3 |
| InChIKey | GAQDBGFGDWEYMS-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |