About 3-bromo-5-butyl-1,2-oxazole
3-bromo-5-butyl-1,2-oxazole (PubChem CID 11367702) has the molecular formula C7H10BrNO
and a molecular weight of 204.07 g/mol. Its IUPAC name is 3-bromo-5-butyl-1,2-oxazole.
Molecular Properties
| Compound Name | 3-bromo-5-butyl-1,2-oxazole |
| PubChem CID | 11367702 |
| Molecular Formula | C7H10BrNO |
| Molecular Weight | 204.07 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | 3-bromo-5-butyl-1,2-oxazole |
| SMILES | CCCCc1cc(Br)no1 |
| InChI | InChI=1S/C7H10BrNO/c1-2-3-4-6-5-7(8)9-10-6/h5H,2-4H2,1H3 |
| InChIKey | RXTJVTXZCYWODZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.07 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-5-butyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-butyl-1,2-oxazole?
The IUPAC name of 3-bromo-5-butyl-1,2-oxazole (CID 11367702) is 3-bromo-5-butyl-1,2-oxazole.
What is the SMILES notation for 3-bromo-5-butyl-1,2-oxazole?
The canonical SMILES for 3-bromo-5-butyl-1,2-oxazole is CCCCc1cc(Br)no1.
What is the InChIKey of 3-bromo-5-butyl-1,2-oxazole?
The InChIKey is RXTJVTXZCYWODZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BrNO/c1-2-3-4-6-5-7(8)9-10-6/h5H,2-4H2,1H3.
What are the key properties of 3-bromo-5-butyl-1,2-oxazole?
3-bromo-5-butyl-1,2-oxazole has a molecular weight of 204.07 g/mol, XLogP of 2.78, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-butyl-1,2-oxazole is sourced from PubChem (CID 11367702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).