C11H16O4 — CID 11367838
(3S,4S,5S)-4-hydroxy-3-[(1R,2E,4E)-1-hydroxyhexa-2,4-dienyl]-5-methyloxolan-2-one (PubChem CID 11367838) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (3S,4S,5S)-4-hydroxy-3-[(1R,2E,4E)-1-hydroxyhexa-2,4-dienyl]-5-methyloxolan-2-one.
| Compound Name | (3S,4S,5S)-4-hydroxy-3-[(1R,2E,4E)-1-hydroxyhexa-2,4-dienyl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 11367838 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (3S,4S,5S)-4-hydroxy-3-[(1R,2E,4E)-1-hydroxyhexa-2,4-dienyl]-5-methyloxolan-2-one |
| SMILES | C/C=C/C=C/[C@@H](O)[C@@H]1C(=O)O[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C11H16O4/c1-3-4-5-6-8(12)9-10(13)7(2)15-11(9)14/h3-10,12-13H,1-2H3/b4-3+,6-5+/t7-,8+,9-,10+/m0/s1 |
| InChIKey | OHCWVMYPRKEIQI-SWPMLGONSA-N |
| XLogP | 0.40 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|