C9H11NO5 — CID 11367859
(1R,2R,6S,9R)-3-methyl-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-4,11-dione (PubChem CID 11367859) has the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. Its IUPAC name is (1R,2R,6S,9R)-3-methyl-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-4,11-dione.
| Compound Name | (1R,2R,6S,9R)-3-methyl-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-4,11-dione |
|---|---|
| PubChem CID | 11367859 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (1R,2R,6S,9R)-3-methyl-5,8,12-trioxa-3-azatricyclo[7.3.0.02,6]dodecane-4,11-dione |
| SMILES | CN1C(=O)O[C@@H]2CO[C@@H]3CC(=O)O[C@@H]3[C@@H]21 |
| InChI | InChI=1S/C9H11NO5/c1-10-7-5(14-9(10)12)3-13-4-2-6(11)15-8(4)7/h4-5,7-8H,2-3H2,1H3/t4-,5-,7-,8+/m1/s1 |
| InChIKey | YVZOKLSNJIEVGF-APOSLCTFSA-N |
| XLogP | -0.48 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |