C11H19FO3 — CID 11367959
ethyl (2S,3S)-2-fluoro-3-hydroxy-2-prop-2-enylhexanoate (PubChem CID 11367959) has the molecular formula C11H19FO3 and a molecular weight of 218.27 g/mol. Its IUPAC name is ethyl (2S,3S)-2-fluoro-3-hydroxy-2-prop-2-enylhexanoate.
| Compound Name | ethyl (2S,3S)-2-fluoro-3-hydroxy-2-prop-2-enylhexanoate |
|---|---|
| PubChem CID | 11367959 |
| Molecular Formula | C11H19FO3 |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | ethyl (2S,3S)-2-fluoro-3-hydroxy-2-prop-2-enylhexanoate |
| SMILES | C=CC[C@@](F)(C(=O)OCC)[C@@H](O)CCC |
| InChI | InChI=1S/C11H19FO3/c1-4-7-9(13)11(12,8-5-2)10(14)15-6-3/h5,9,13H,2,4,6-8H2,1,3H3/t9-,11-/m0/s1 |
| InChIKey | XWPCOWMKQYDKSY-ONGXEEELSA-N |
| XLogP | 1.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|