About 4-diethoxyphosphoryl-5-methyl-2,3-dihydrofuran
4-diethoxyphosphoryl-5-methyl-2,3-dihydrofuran (PubChem CID 11368001) has the molecular formula C9H17O4P
and a molecular weight of 220.20 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-5-methyl-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 4-diethoxyphosphoryl-5-methyl-2,3-dihydrofuran |
| PubChem CID | 11368001 |
| Molecular Formula | C9H17O4P |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 4-diethoxyphosphoryl-5-methyl-2,3-dihydrofuran |
| SMILES | CCOP(=O)(OCC)C1=C(C)OCC1 |
| InChI | InChI=1S/C9H17O4P/c1-4-12-14(10,13-5-2)9-6-7-11-8(9)3/h4-7H2,1-3H3 |
| InChIKey | VVNHECWQTVSOSY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-diethoxyphosphoryl-5-methyl-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diethoxyphosphoryl-5-methyl-2,3-dihydrofuran?
The IUPAC name of 4-diethoxyphosphoryl-5-methyl-2,3-dihydrofuran (CID 11368001) is 4-diethoxyphosphoryl-5-methyl-2,3-dihydrofuran.
What is the SMILES notation for 4-diethoxyphosphoryl-5-methyl-2,3-dihydrofuran?
The canonical SMILES for 4-diethoxyphosphoryl-5-methyl-2,3-dihydrofuran is CCOP(=O)(OCC)C1=C(C)OCC1.
What is the InChIKey of 4-diethoxyphosphoryl-5-methyl-2,3-dihydrofuran?
The InChIKey is VVNHECWQTVSOSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17O4P/c1-4-12-14(10,13-5-2)9-6-7-11-8(9)3/h4-7H2,1-3H3.
What are the key properties of 4-diethoxyphosphoryl-5-methyl-2,3-dihydrofuran?
4-diethoxyphosphoryl-5-methyl-2,3-dihydrofuran has a molecular weight of 220.20 g/mol, XLogP of 2.90, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diethoxyphosphoryl-5-methyl-2,3-dihydrofuran is sourced from PubChem (CID 11368001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).