About benzyl N-(3-oxobutyl)carbamate
benzyl N-(3-oxobutyl)carbamate (PubChem CID 11368024) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is benzyl N-(3-oxobutyl)carbamate.
Molecular Properties
| Compound Name | benzyl N-(3-oxobutyl)carbamate |
| PubChem CID | 11368024 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | benzyl N-(3-oxobutyl)carbamate |
| SMILES | CC(=O)CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C12H15NO3/c1-10(14)7-8-13-12(15)16-9-11-5-3-2-4-6-11/h2-6H,7-9H2,1H3,(H,13,15) |
| InChIKey | QVWVVHRNMKYYBJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl N-(3-oxobutyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-(3-oxobutyl)carbamate?
The IUPAC name of benzyl N-(3-oxobutyl)carbamate (CID 11368024) is benzyl N-(3-oxobutyl)carbamate.
What is the SMILES notation for benzyl N-(3-oxobutyl)carbamate?
The canonical SMILES for benzyl N-(3-oxobutyl)carbamate is CC(=O)CCNC(=O)OCc1ccccc1.
What is the InChIKey of benzyl N-(3-oxobutyl)carbamate?
The InChIKey is QVWVVHRNMKYYBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3/c1-10(14)7-8-13-12(15)16-9-11-5-3-2-4-6-11/h2-6H,7-9H2,1H3,(H,13,15).
What are the key properties of benzyl N-(3-oxobutyl)carbamate?
benzyl N-(3-oxobutyl)carbamate has a molecular weight of 221.26 g/mol, XLogP of 1.89, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-(3-oxobutyl)carbamate is sourced from PubChem (CID 11368024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).