C8H17O5P — CID 11368084
1-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]propan-2-ol (PubChem CID 11368084) has the molecular formula C8H17O5P and a molecular weight of 224.19 g/mol. Its IUPAC name is 1-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]propan-2-ol.
| Compound Name | 1-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]propan-2-ol |
|---|---|
| PubChem CID | 11368084 |
| Molecular Formula | C8H17O5P |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 1-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]propan-2-ol |
| SMILES | CC(O)COP1(=O)OCC(C)(C)CO1 |
| InChI | InChI=1S/C8H17O5P/c1-7(9)4-11-14(10)12-5-8(2,3)6-13-14/h7,9H,4-6H2,1-3H3 |
| InChIKey | DNBXDELUBOCDHY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|