C14H17NO2 — CID 11368239
(1R,5S,6R)-6-phenyl-3,7-dioxa-8-azatricyclo[6.3.0.01,5]undecane (PubChem CID 11368239) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is (1R,5S,6R)-6-phenyl-3,7-dioxa-8-azatricyclo[6.3.0.01,5]undecane.
| Compound Name | (1R,5S,6R)-6-phenyl-3,7-dioxa-8-azatricyclo[6.3.0.01,5]undecane |
|---|---|
| PubChem CID | 11368239 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (1R,5S,6R)-6-phenyl-3,7-dioxa-8-azatricyclo[6.3.0.01,5]undecane |
| SMILES | c1ccc([C@@H]2ON3CCC[C@@]34COC[C@@H]24)cc1 |
| InChI | InChI=1S/C14H17NO2/c1-2-5-11(6-3-1)13-12-9-16-10-14(12)7-4-8-15(14)17-13/h1-3,5-6,12-13H,4,7-10H2/t12-,13-,14-/m0/s1 |
| InChIKey | HDORDDXJRUTMFV-IHRRRGAJSA-N |
| XLogP | 2.15 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |