C14H18O3 — CID 11368312
(4'aR,8'S,8'aS)-2',8'-dimethylspiro[1,3-dioxolane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one (PubChem CID 11368312) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (4'aR,8'S,8'aS)-2',8'-dimethylspiro[1,3-dioxolane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one.
| Compound Name | (4'aR,8'S,8'aS)-2',8'-dimethylspiro[1,3-dioxolane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 11368312 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (4'aR,8'S,8'aS)-2',8'-dimethylspiro[1,3-dioxolane-2,4'-4a,5,8,8a-tetrahydronaphthalene]-1'-one |
| SMILES | CC1=CC2(OCCO2)[C@@H]2CC=C[C@H](C)[C@@H]2C1=O |
| InChI | InChI=1S/C14H18O3/c1-9-4-3-5-11-12(9)13(15)10(2)8-14(11)16-6-7-17-14/h3-4,8-9,11-12H,5-7H2,1-2H3/t9-,11+,12-/m0/s1 |
| InChIKey | MCIWBNHHSLALCV-WCQGTBRESA-N |
| XLogP | 2.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|