About 1-pent-4-enylpyrrolo[1,2-a]quinoline
1-pent-4-enylpyrrolo[1,2-a]quinoline (PubChem CID 11368341) has the molecular formula C17H17N
and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-pent-4-enylpyrrolo[1,2-a]quinoline.
Molecular Properties
| Compound Name | 1-pent-4-enylpyrrolo[1,2-a]quinoline |
| PubChem CID | 11368341 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 1-pent-4-enylpyrrolo[1,2-a]quinoline |
| SMILES | C=CCCCc1ccc2ccc3ccccc3n12 |
| InChI | InChI=1S/C17H17N/c1-2-3-4-8-15-12-13-16-11-10-14-7-5-6-9-17(14)18(15)16/h2,5-7,9-13H,1,3-4,8H2 |
| InChIKey | YUZMAMGKSFCKGJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-pent-4-enylpyrrolo[1,2-a]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pent-4-enylpyrrolo[1,2-a]quinoline?
The IUPAC name of 1-pent-4-enylpyrrolo[1,2-a]quinoline (CID 11368341) is 1-pent-4-enylpyrrolo[1,2-a]quinoline.
What is the SMILES notation for 1-pent-4-enylpyrrolo[1,2-a]quinoline?
The canonical SMILES for 1-pent-4-enylpyrrolo[1,2-a]quinoline is C=CCCCc1ccc2ccc3ccccc3n12.
What is the InChIKey of 1-pent-4-enylpyrrolo[1,2-a]quinoline?
The InChIKey is YUZMAMGKSFCKGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N/c1-2-3-4-8-15-12-13-16-11-10-14-7-5-6-9-17(14)18(15)16/h2,5-7,9-13H,1,3-4,8H2.
What are the key properties of 1-pent-4-enylpyrrolo[1,2-a]quinoline?
1-pent-4-enylpyrrolo[1,2-a]quinoline has a molecular weight of 235.33 g/mol, XLogP of 4.60, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pent-4-enylpyrrolo[1,2-a]quinoline is sourced from PubChem (CID 11368341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).