C15H26O2 — CID 11368417
10-hydroxy-2,6,10-trimethyldodeca-2,11-dien-4-one (PubChem CID 11368417) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 10-hydroxy-2,6,10-trimethyldodeca-2,11-dien-4-one.
| Compound Name | 10-hydroxy-2,6,10-trimethyldodeca-2,11-dien-4-one |
|---|---|
| PubChem CID | 11368417 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 10-hydroxy-2,6,10-trimethyldodeca-2,11-dien-4-one |
| SMILES | C=CC(C)(O)CCCC(C)CC(=O)C=C(C)C |
| InChI | InChI=1S/C15H26O2/c1-6-15(5,17)9-7-8-13(4)11-14(16)10-12(2)3/h6,10,13,17H,1,7-9,11H2,2-5H3 |
| InChIKey | VQLQYAMTNKORFK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|