C15H20O3 — CID 11368654
4-methoxy-3,5-dimethyl-6-[(2E,4Z)-4-methylhexa-2,4-dien-2-yl]pyran-2-one (PubChem CID 11368654) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 4-methoxy-3,5-dimethyl-6-[(2E,4Z)-4-methylhexa-2,4-dien-2-yl]pyran-2-one.
| Compound Name | 4-methoxy-3,5-dimethyl-6-[(2E,4Z)-4-methylhexa-2,4-dien-2-yl]pyran-2-one |
|---|---|
| PubChem CID | 11368654 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-methoxy-3,5-dimethyl-6-[(2E,4Z)-4-methylhexa-2,4-dien-2-yl]pyran-2-one |
| SMILES | C/C=C(C)\C=C(/C)c1oc(=O)c(C)c(OC)c1C |
| InChI | InChI=1S/C15H20O3/c1-7-9(2)8-10(3)13-11(4)14(17-6)12(5)15(16)18-13/h7-8H,1-6H3/b9-7-,10-8+ |
| InChIKey | IFHBFWLMLSPISM-FKJILZIQSA-N |
| XLogP | 3.63 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|