C12H24N6 — CID 11368773
2-N,4-N,6-N-tripropyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 11368773) has the molecular formula C12H24N6 and a molecular weight of 252.37 g/mol. Its IUPAC name is 2-N,4-N,6-N-tripropyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tripropyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 11368773 |
| Molecular Formula | C12H24N6 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 2-N,4-N,6-N-tripropyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCNc1nc(NCCC)nc(NCCC)n1 |
| InChI | InChI=1S/C12H24N6/c1-4-7-13-10-16-11(14-8-5-2)18-12(17-10)15-9-6-3/h4-9H2,1-3H3,(H3,13,14,15,16,17,18) |
| InChIKey | APSYKKQDFLXLLX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |