C15H14N2O2 — CID 11368816
(7aS)-5,7,7a,8,9,10-hexahydroindolizino[7,6-c]quinoline-6,12-dione (PubChem CID 11368816) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is (7aS)-5,7,7a,8,9,10-hexahydroindolizino[7,6-c]quinoline-6,12-dione.
| Compound Name | (7aS)-5,7,7a,8,9,10-hexahydroindolizino[7,6-c]quinoline-6,12-dione |
|---|---|
| PubChem CID | 11368816 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (7aS)-5,7,7a,8,9,10-hexahydroindolizino[7,6-c]quinoline-6,12-dione |
| SMILES | O=C1c2c(c(=O)[nH]c3ccccc23)C[C@@H]2CCCN12 |
| InChI | InChI=1S/C15H14N2O2/c18-14-11-8-9-4-3-7-17(9)15(19)13(11)10-5-1-2-6-12(10)16-14/h1-2,5-6,9H,3-4,7-8H2,(H,16,18)/t9-/m0/s1 |
| InChIKey | XKTLJPBGUKRGDX-VIFPVBQESA-N |
| XLogP | 1.69 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |