C10H13N3O5 — CID 11368844
2-(9-nitro-6-oxo-1,2,3,4,7,8-hexahydropyrido[1,2-a]pyrimidin-7-yl)acetic acid (PubChem CID 11368844) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is 2-(9-nitro-6-oxo-1,2,3,4,7,8-hexahydropyrido[1,2-a]pyrimidin-7-yl)acetic acid.
| Compound Name | 2-(9-nitro-6-oxo-1,2,3,4,7,8-hexahydropyrido[1,2-a]pyrimidin-7-yl)acetic acid |
|---|---|
| PubChem CID | 11368844 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-(9-nitro-6-oxo-1,2,3,4,7,8-hexahydropyrido[1,2-a]pyrimidin-7-yl)acetic acid |
| SMILES | O=C(O)CC1CC([N+](=O)[O-])=C2NCCCN2C1=O |
| InChI | InChI=1S/C10H13N3O5/c14-8(15)5-6-4-7(13(17)18)9-11-2-1-3-12(9)10(6)16/h6,11H,1-5H2,(H,14,15) |
| InChIKey | ZJHYDFINGXYLSH-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|