C12H14N2O5 — CID 11369122
1-methyl-3-[(2-methyl-4-methylidene-5-oxooxolan-2-yl)methoxy]pyrazole-5-carboxylic acid (PubChem CID 11369122) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is 1-methyl-3-[(2-methyl-4-methylidene-5-oxooxolan-2-yl)methoxy]pyrazole-5-carboxylic acid.
| Compound Name | 1-methyl-3-[(2-methyl-4-methylidene-5-oxooxolan-2-yl)methoxy]pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 11369122 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-methyl-3-[(2-methyl-4-methylidene-5-oxooxolan-2-yl)methoxy]pyrazole-5-carboxylic acid |
| SMILES | C=C1CC(C)(COc2cc(C(=O)O)n(C)n2)OC1=O |
| InChI | InChI=1S/C12H14N2O5/c1-7-5-12(2,19-11(7)17)6-18-9-4-8(10(15)16)14(3)13-9/h4H,1,5-6H2,2-3H3,(H,15,16) |
| InChIKey | NTIHDRDBKOUVEY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|