About 1,5-dipyridin-2-ylpentane-1,3,5-trione
1,5-dipyridin-2-ylpentane-1,3,5-trione (PubChem CID 11369181) has the molecular formula C15H12N2O3
and a molecular weight of 268.27 g/mol. Its IUPAC name is 1,5-dipyridin-2-ylpentane-1,3,5-trione.
Molecular Properties
| Compound Name | 1,5-dipyridin-2-ylpentane-1,3,5-trione |
| PubChem CID | 11369181 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 1,5-dipyridin-2-ylpentane-1,3,5-trione |
| SMILES | O=C(CC(=O)c1ccccn1)CC(=O)c1ccccn1 |
| InChI | InChI=1S/C15H12N2O3/c18-11(9-14(19)12-5-1-3-7-16-12)10-15(20)13-6-2-4-8-17-13/h1-8H,9-10H2 |
| InChIKey | UXCBOWMRKBJEGR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dipyridin-2-ylpentane-1,3,5-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dipyridin-2-ylpentane-1,3,5-trione?
The IUPAC name of 1,5-dipyridin-2-ylpentane-1,3,5-trione (CID 11369181) is 1,5-dipyridin-2-ylpentane-1,3,5-trione.
What is the SMILES notation for 1,5-dipyridin-2-ylpentane-1,3,5-trione?
The canonical SMILES for 1,5-dipyridin-2-ylpentane-1,3,5-trione is O=C(CC(=O)c1ccccn1)CC(=O)c1ccccn1.
What is the InChIKey of 1,5-dipyridin-2-ylpentane-1,3,5-trione?
The InChIKey is UXCBOWMRKBJEGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O3/c18-11(9-14(19)12-5-1-3-7-16-12)10-15(20)13-6-2-4-8-17-13/h1-8H,9-10H2.
What are the key properties of 1,5-dipyridin-2-ylpentane-1,3,5-trione?
1,5-dipyridin-2-ylpentane-1,3,5-trione has a molecular weight of 268.27 g/mol, XLogP of 1.89, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dipyridin-2-ylpentane-1,3,5-trione is sourced from PubChem (CID 11369181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).