C16H30O3 — CID 11369254
(2R,3S)-3-methyl-1-[(4S,5S,6R)-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxan-4-yl]pent-4-en-2-ol (PubChem CID 11369254) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is (2R,3S)-3-methyl-1-[(4S,5S,6R)-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxan-4-yl]pent-4-en-2-ol.
| Compound Name | (2R,3S)-3-methyl-1-[(4S,5S,6R)-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxan-4-yl]pent-4-en-2-ol |
|---|---|
| PubChem CID | 11369254 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | (2R,3S)-3-methyl-1-[(4S,5S,6R)-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxan-4-yl]pent-4-en-2-ol |
| SMILES | C=C[C@H](C)[C@H](O)C[C@@H]1OC(C)(C)O[C@H](C(C)C)[C@H]1C |
| InChI | InChI=1S/C16H30O3/c1-8-11(4)13(17)9-14-12(5)15(10(2)3)19-16(6,7)18-14/h8,10-15,17H,1,9H2,2-7H3/t11-,12-,13+,14-,15+/m0/s1 |
| InChIKey | GLTPZKYLIPDPHN-SBJFKYEJSA-N |
| XLogP | 3.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|