About 2-[ethenoxy(1,3-thiazol-2-yl)methyl]-1,3-benzothiazole
2-[ethenoxy(1,3-thiazol-2-yl)methyl]-1,3-benzothiazole (PubChem CID 11369367) has the molecular formula C13H10N2OS2
and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-[ethenoxy(1,3-thiazol-2-yl)methyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[ethenoxy(1,3-thiazol-2-yl)methyl]-1,3-benzothiazole |
| PubChem CID | 11369367 |
| Molecular Formula | C13H10N2OS2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-[ethenoxy(1,3-thiazol-2-yl)methyl]-1,3-benzothiazole |
| SMILES | C=COC(c1nccs1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H10N2OS2/c1-2-16-11(12-14-7-8-17-12)13-15-9-5-3-4-6-10(9)18-13/h2-8,11H,1H2 |
| InChIKey | ILDOSRRUDSGMGW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-[ethenoxy(1,3-thiazol-2-yl)methyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethenoxy(1,3-thiazol-2-yl)methyl]-1,3-benzothiazole?
The IUPAC name of 2-[ethenoxy(1,3-thiazol-2-yl)methyl]-1,3-benzothiazole (CID 11369367) is 2-[ethenoxy(1,3-thiazol-2-yl)methyl]-1,3-benzothiazole.
What is the SMILES notation for 2-[ethenoxy(1,3-thiazol-2-yl)methyl]-1,3-benzothiazole?
The canonical SMILES for 2-[ethenoxy(1,3-thiazol-2-yl)methyl]-1,3-benzothiazole is C=COC(c1nccs1)c1nc2ccccc2s1.
What is the InChIKey of 2-[ethenoxy(1,3-thiazol-2-yl)methyl]-1,3-benzothiazole?
The InChIKey is ILDOSRRUDSGMGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2OS2/c1-2-16-11(12-14-7-8-17-12)13-15-9-5-3-4-6-10(9)18-13/h2-8,11H,1H2.
What are the key properties of 2-[ethenoxy(1,3-thiazol-2-yl)methyl]-1,3-benzothiazole?
2-[ethenoxy(1,3-thiazol-2-yl)methyl]-1,3-benzothiazole has a molecular weight of 274.37 g/mol, XLogP of 4.00, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethenoxy(1,3-thiazol-2-yl)methyl]-1,3-benzothiazole is sourced from PubChem (CID 11369367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).