About (2S)-2-acetamido-3-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]propanoic acid
(2S)-2-acetamido-3-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]propanoic acid (PubChem CID 11369387) has the molecular formula C9H13N3O5S
and a molecular weight of 275.29 g/mol. Its IUPAC name is (2S)-2-acetamido-3-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]propanoic acid.
Molecular Properties
| Compound Name | (2S)-2-acetamido-3-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]propanoic acid |
| PubChem CID | 11369387 |
| Molecular Formula | C9H13N3O5S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | (2S)-2-acetamido-3-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]propanoic acid |
| SMILES | CC(=O)N[C@H](CSCC1NC(=O)NC1=O)C(=O)O |
| InChI | InChI=1S/C9H13N3O5S/c1-4(13)10-6(8(15)16)3-18-2-5-7(14)12-9(17)11-5/h5-6H,2-3H2,1H3,(H,10,13)(H,15,16)(H2,11,12,14,17)/t5?,6-/m1/s1 |
| InChIKey | OCKLEMIKDNOHOG-PRJDIBJQSA-N |
| XLogP | -1.48 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-acetamido-3-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-acetamido-3-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]propanoic acid?
The IUPAC name of (2S)-2-acetamido-3-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]propanoic acid (CID 11369387) is (2S)-2-acetamido-3-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]propanoic acid.
What is the SMILES notation for (2S)-2-acetamido-3-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]propanoic acid?
The canonical SMILES for (2S)-2-acetamido-3-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]propanoic acid is CC(=O)N[C@H](CSCC1NC(=O)NC1=O)C(=O)O.
What is the InChIKey of (2S)-2-acetamido-3-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]propanoic acid?
The InChIKey is OCKLEMIKDNOHOG-PRJDIBJQSA-N. The full InChI is InChI=1S/C9H13N3O5S/c1-4(13)10-6(8(15)16)3-18-2-5-7(14)12-9(17)11-5/h5-6H,2-3H2,1H3,(H,10,13)(H,15,16)(H2,11,12,14,17)/t5?,6-/m1/s1.
What are the key properties of (2S)-2-acetamido-3-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]propanoic acid?
(2S)-2-acetamido-3-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]propanoic acid has a molecular weight of 275.29 g/mol, XLogP of -1.48, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-acetamido-3-[(2,5-dioxoimidazolidin-4-yl)methylsulfanyl]propanoic acid is sourced from PubChem (CID 11369387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).