C8H10N4 — CID 11369405
6-(2-aminoethylamino)pyridine-3-carbonitrile (PubChem CID 11369405) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 6-(2-aminoethylamino)pyridine-3-carbonitrile.
| Compound Name | 6-(2-aminoethylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 11369405 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 6-(2-aminoethylamino)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NCCN)nc1 |
| InChI | InChI=1S/C8H10N4/c9-3-4-11-8-2-1-7(5-10)6-12-8/h1-2,6H,3-4,9H2,(H,11,12) |
| InChIKey | NIUAJYOMWZYSQR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |