About 3-methoxy-5-methyl-6,6-bis(3-methylbut-2-enyl)cyclohex-2-en-1-one
3-methoxy-5-methyl-6,6-bis(3-methylbut-2-enyl)cyclohex-2-en-1-one (PubChem CID 11369428) has the molecular formula C18H28O2
and a molecular weight of 276.42 g/mol. Its IUPAC name is 3-methoxy-5-methyl-6,6-bis(3-methylbut-2-enyl)cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-methoxy-5-methyl-6,6-bis(3-methylbut-2-enyl)cyclohex-2-en-1-one |
| PubChem CID | 11369428 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 3-methoxy-5-methyl-6,6-bis(3-methylbut-2-enyl)cyclohex-2-en-1-one |
| SMILES | COC1=CC(=O)C(CC=C(C)C)(CC=C(C)C)C(C)C1 |
| InChI | InChI=1S/C18H28O2/c1-13(2)7-9-18(10-8-14(3)4)15(5)11-16(20-6)12-17(18)19/h7-8,12,15H,9-11H2,1-6H3 |
| InChIKey | RQEFMKOTLLULKP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-5-methyl-6,6-bis(3-methylbut-2-enyl)cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-5-methyl-6,6-bis(3-methylbut-2-enyl)cyclohex-2-en-1-one?
The IUPAC name of 3-methoxy-5-methyl-6,6-bis(3-methylbut-2-enyl)cyclohex-2-en-1-one (CID 11369428) is 3-methoxy-5-methyl-6,6-bis(3-methylbut-2-enyl)cyclohex-2-en-1-one.
What is the SMILES notation for 3-methoxy-5-methyl-6,6-bis(3-methylbut-2-enyl)cyclohex-2-en-1-one?
The canonical SMILES for 3-methoxy-5-methyl-6,6-bis(3-methylbut-2-enyl)cyclohex-2-en-1-one is COC1=CC(=O)C(CC=C(C)C)(CC=C(C)C)C(C)C1.
What is the InChIKey of 3-methoxy-5-methyl-6,6-bis(3-methylbut-2-enyl)cyclohex-2-en-1-one?
The InChIKey is RQEFMKOTLLULKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O2/c1-13(2)7-9-18(10-8-14(3)4)15(5)11-16(20-6)12-17(18)19/h7-8,12,15H,9-11H2,1-6H3.
What are the key properties of 3-methoxy-5-methyl-6,6-bis(3-methylbut-2-enyl)cyclohex-2-en-1-one?
3-methoxy-5-methyl-6,6-bis(3-methylbut-2-enyl)cyclohex-2-en-1-one has a molecular weight of 276.42 g/mol, XLogP of 4.82, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-5-methyl-6,6-bis(3-methylbut-2-enyl)cyclohex-2-en-1-one is sourced from PubChem (CID 11369428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).