About (3S,4R)-6-bromo-4-ethynyl-3-prop-1-en-2-yl-3,4-dihydro-2H-chromene
(3S,4R)-6-bromo-4-ethynyl-3-prop-1-en-2-yl-3,4-dihydro-2H-chromene (PubChem CID 11369434) has the molecular formula C14H13BrO
and a molecular weight of 277.16 g/mol. Its IUPAC name is (3S,4R)-6-bromo-4-ethynyl-3-prop-1-en-2-yl-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | (3S,4R)-6-bromo-4-ethynyl-3-prop-1-en-2-yl-3,4-dihydro-2H-chromene |
| PubChem CID | 11369434 |
| Molecular Formula | C14H13BrO |
| Molecular Weight | 277.16 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | (3S,4R)-6-bromo-4-ethynyl-3-prop-1-en-2-yl-3,4-dihydro-2H-chromene |
| SMILES | C#C[C@@H]1c2cc(Br)ccc2OC[C@@H]1C(=C)C |
| InChI | InChI=1S/C14H13BrO/c1-4-11-12-7-10(15)5-6-14(12)16-8-13(11)9(2)3/h1,5-7,11,13H,2,8H2,3H3/t11-,13-/m1/s1 |
| InChIKey | ZOKGFVQDFBFSKC-DGCLKSJQSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.16 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S,4R)-6-bromo-4-ethynyl-3-prop-1-en-2-yl-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-6-bromo-4-ethynyl-3-prop-1-en-2-yl-3,4-dihydro-2H-chromene?
The IUPAC name of (3S,4R)-6-bromo-4-ethynyl-3-prop-1-en-2-yl-3,4-dihydro-2H-chromene (CID 11369434) is (3S,4R)-6-bromo-4-ethynyl-3-prop-1-en-2-yl-3,4-dihydro-2H-chromene.
What is the SMILES notation for (3S,4R)-6-bromo-4-ethynyl-3-prop-1-en-2-yl-3,4-dihydro-2H-chromene?
The canonical SMILES for (3S,4R)-6-bromo-4-ethynyl-3-prop-1-en-2-yl-3,4-dihydro-2H-chromene is C#C[C@@H]1c2cc(Br)ccc2OC[C@@H]1C(=C)C.
What is the InChIKey of (3S,4R)-6-bromo-4-ethynyl-3-prop-1-en-2-yl-3,4-dihydro-2H-chromene?
The InChIKey is ZOKGFVQDFBFSKC-DGCLKSJQSA-N. The full InChI is InChI=1S/C14H13BrO/c1-4-11-12-7-10(15)5-6-14(12)16-8-13(11)9(2)3/h1,5-7,11,13H,2,8H2,3H3/t11-,13-/m1/s1.
What are the key properties of (3S,4R)-6-bromo-4-ethynyl-3-prop-1-en-2-yl-3,4-dihydro-2H-chromene?
(3S,4R)-6-bromo-4-ethynyl-3-prop-1-en-2-yl-3,4-dihydro-2H-chromene has a molecular weight of 277.16 g/mol, XLogP of 3.75, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-6-bromo-4-ethynyl-3-prop-1-en-2-yl-3,4-dihydro-2H-chromene is sourced from PubChem (CID 11369434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).