C11H13N3O2S2 — CID 11369599
N-[3-(1H-imidazol-5-ylsulfanyl)phenyl]ethanesulfonamide (PubChem CID 11369599) has the molecular formula C11H13N3O2S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is N-[3-(1H-imidazol-5-ylsulfanyl)phenyl]ethanesulfonamide.
| Compound Name | N-[3-(1H-imidazol-5-ylsulfanyl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 11369599 |
| Molecular Formula | C11H13N3O2S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | N-[3-(1H-imidazol-5-ylsulfanyl)phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1cccc(Sc2cnc[nH]2)c1 |
| InChI | InChI=1S/C11H13N3O2S2/c1-2-18(15,16)14-9-4-3-5-10(6-9)17-11-7-12-8-13-11/h3-8,14H,2H2,1H3,(H,12,13) |
| InChIKey | HZGSCIGEIICANA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |