C16H29NO3 — CID 11369600
tert-butyl (4S,5S)-5-ethenyl-2,2-dimethyl-4-(2-methylpropyl)-1,3-oxazolidine-3-carboxylate (PubChem CID 11369600) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is tert-butyl (4S,5S)-5-ethenyl-2,2-dimethyl-4-(2-methylpropyl)-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-5-ethenyl-2,2-dimethyl-4-(2-methylpropyl)-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11369600 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | tert-butyl (4S,5S)-5-ethenyl-2,2-dimethyl-4-(2-methylpropyl)-1,3-oxazolidine-3-carboxylate |
| SMILES | C=C[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1CC(C)C |
| InChI | InChI=1S/C16H29NO3/c1-9-13-12(10-11(2)3)17(16(7,8)19-13)14(18)20-15(4,5)6/h9,11-13H,1,10H2,2-8H3/t12-,13-/m0/s1 |
| InChIKey | PVEHYEJIVLSFPK-STQMWFEESA-N |
| XLogP | 3.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|