C16H28O4 — CID 11369629
methyl 2-[(3R,6S)-4,6-diethyl-6-pentyl-3H-1,2-dioxin-3-yl]acetate (PubChem CID 11369629) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is methyl 2-[(3R,6S)-4,6-diethyl-6-pentyl-3H-1,2-dioxin-3-yl]acetate.
| Compound Name | methyl 2-[(3R,6S)-4,6-diethyl-6-pentyl-3H-1,2-dioxin-3-yl]acetate |
|---|---|
| PubChem CID | 11369629 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | methyl 2-[(3R,6S)-4,6-diethyl-6-pentyl-3H-1,2-dioxin-3-yl]acetate |
| SMILES | CCCCC[C@@]1(CC)C=C(CC)[C@@H](CC(=O)OC)OO1 |
| InChI | InChI=1S/C16H28O4/c1-5-8-9-10-16(7-3)12-13(6-2)14(19-20-16)11-15(17)18-4/h12,14H,5-11H2,1-4H3/t14-,16+/m1/s1 |
| InChIKey | GPYRVTKLZXIKRF-ZBFHGGJFSA-N |
| XLogP | 3.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|