C14H10F4O2 — CID 11369659
4-[1,1,2,2-tetrafluoro-2-(4-hydroxyphenyl)ethyl]phenol (PubChem CID 11369659) has the molecular formula C14H10F4O2 and a molecular weight of 286.22 g/mol. Its IUPAC name is 4-[1,1,2,2-tetrafluoro-2-(4-hydroxyphenyl)ethyl]phenol.
| Compound Name | 4-[1,1,2,2-tetrafluoro-2-(4-hydroxyphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 11369659 |
| Molecular Formula | C14H10F4O2 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 4-[1,1,2,2-tetrafluoro-2-(4-hydroxyphenyl)ethyl]phenol |
| SMILES | Oc1ccc(C(F)(F)C(F)(F)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C14H10F4O2/c15-13(16,9-1-5-11(19)6-2-9)14(17,18)10-3-7-12(20)8-4-10/h1-8,19-20H |
| InChIKey | YFWMKHJNNZCGHF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|