C15H30O3Si — CID 11369681
tert-butyl-[[(4R,5R)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane (PubChem CID 11369681) has the molecular formula C15H30O3Si and a molecular weight of 286.49 g/mol. Its IUPAC name is tert-butyl-[[(4R,5R)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(4R,5R)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11369681 |
| Molecular Formula | C15H30O3Si |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | tert-butyl-[[(4R,5R)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane |
| SMILES | C=C(C)[C@H]1OC(C)(C)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O3Si/c1-11(2)13-12(17-15(6,7)18-13)10-16-19(8,9)14(3,4)5/h12-13H,1,10H2,2-9H3/t12-,13-/m1/s1 |
| InChIKey | BIATWPPSZPSHGA-CHWSQXEVSA-N |
| XLogP | 4.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|