C17H23NO3 — CID 11369751
N-benzyl-3-(1,4-dioxaspiro[4.4]nonan-9-yl)propanamide (PubChem CID 11369751) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is N-benzyl-3-(1,4-dioxaspiro[4.4]nonan-9-yl)propanamide.
| Compound Name | N-benzyl-3-(1,4-dioxaspiro[4.4]nonan-9-yl)propanamide |
|---|---|
| PubChem CID | 11369751 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-benzyl-3-(1,4-dioxaspiro[4.4]nonan-9-yl)propanamide |
| SMILES | O=C(CCC1CCCC12OCCO2)NCc1ccccc1 |
| InChI | InChI=1S/C17H23NO3/c19-16(18-13-14-5-2-1-3-6-14)9-8-15-7-4-10-17(15)20-11-12-21-17/h1-3,5-6,15H,4,7-13H2,(H,18,19) |
| InChIKey | SZWYFJVEFHARPL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |