C17H26N2O2 — CID 11369789
(2S,5S)-2-tert-butyl-5-[2-(cyclohexen-1-yl)ethynyl]-1-hydroxy-3,5-dimethylimidazolidin-4-one (PubChem CID 11369789) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (2S,5S)-2-tert-butyl-5-[2-(cyclohexen-1-yl)ethynyl]-1-hydroxy-3,5-dimethylimidazolidin-4-one.
| Compound Name | (2S,5S)-2-tert-butyl-5-[2-(cyclohexen-1-yl)ethynyl]-1-hydroxy-3,5-dimethylimidazolidin-4-one |
|---|---|
| PubChem CID | 11369789 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (2S,5S)-2-tert-butyl-5-[2-(cyclohexen-1-yl)ethynyl]-1-hydroxy-3,5-dimethylimidazolidin-4-one |
| SMILES | CN1C(=O)[C@](C)(C#CC2=CCCCC2)N(O)[C@H]1C(C)(C)C |
| InChI | InChI=1S/C17H26N2O2/c1-16(2,3)14-18(5)15(20)17(4,19(14)21)12-11-13-9-7-6-8-10-13/h9,14,21H,6-8,10H2,1-5H3/t14-,17-/m0/s1 |
| InChIKey | YCSCAQZWDGYSPK-YOEHRIQHSA-N |
| XLogP | 2.78 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|