C14H30O4Si — CID 11369794
methyl (2R,3S,4S)-5-hydroxy-2,4-dimethyl-3-triethylsilyloxypentanoate (PubChem CID 11369794) has the molecular formula C14H30O4Si and a molecular weight of 290.48 g/mol. Its IUPAC name is methyl (2R,3S,4S)-5-hydroxy-2,4-dimethyl-3-triethylsilyloxypentanoate.
| Compound Name | methyl (2R,3S,4S)-5-hydroxy-2,4-dimethyl-3-triethylsilyloxypentanoate |
|---|---|
| PubChem CID | 11369794 |
| Molecular Formula | C14H30O4Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | methyl (2R,3S,4S)-5-hydroxy-2,4-dimethyl-3-triethylsilyloxypentanoate |
| SMILES | CC[Si](CC)(CC)O[C@@H]([C@@H](C)CO)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C14H30O4Si/c1-7-19(8-2,9-3)18-13(11(4)10-15)12(5)14(16)17-6/h11-13,15H,7-10H2,1-6H3/t11-,12+,13-/m0/s1 |
| InChIKey | MUSLKFFTJDNHPJ-XQQFMLRXSA-N |
| XLogP | 2.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|